About magnesium;tert-butyl (E)-3-phenylprop-2-enoate;chloride
magnesium;tert-butyl (E)-3-phenylprop-2-enoate;chloride (PubChem CID 126744440) has the molecular formula C13H15ClMgO2
and a molecular weight of 263.02 g/mol. Its IUPAC name is magnesium;tert-butyl (E)-3-phenylprop-2-enoate;chloride.
Molecular Properties
| Compound Name | magnesium;tert-butyl (E)-3-phenylprop-2-enoate;chloride |
| PubChem CID | 126744440 |
| Molecular Formula | C13H15ClMgO2 |
| Molecular Weight | 263.02 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | magnesium;tert-butyl (E)-3-phenylprop-2-enoate;chloride |
| SMILES | CC(C)(C)OC(=O)/C=C/c1cc[c-]cc1.[Cl-].[Mg+2] |
| InChI | InChI=1S/C13H15O2.ClH.Mg/c1-13(2,3)15-12(14)10-9-11-7-5-4-6-8-11;;/h5-10H,1-3H3;1H;/q-1;;+2/p-1/b10-9+;; |
| InChIKey | CHGCIJCSYAHIDW-TTWKNDKESA-M |
| XLogP | -0.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.02 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze magnesium;tert-butyl (E)-3-phenylprop-2-enoate;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;tert-butyl (E)-3-phenylprop-2-enoate;chloride?
The IUPAC name of magnesium;tert-butyl (E)-3-phenylprop-2-enoate;chloride (CID 126744440) is magnesium;tert-butyl (E)-3-phenylprop-2-enoate;chloride.
What is the SMILES notation for magnesium;tert-butyl (E)-3-phenylprop-2-enoate;chloride?
The canonical SMILES for magnesium;tert-butyl (E)-3-phenylprop-2-enoate;chloride is CC(C)(C)OC(=O)/C=C/c1cc[c-]cc1.[Cl-].[Mg+2].
What is the InChIKey of magnesium;tert-butyl (E)-3-phenylprop-2-enoate;chloride?
The InChIKey is CHGCIJCSYAHIDW-TTWKNDKESA-M. The full InChI is InChI=1S/C13H15O2.ClH.Mg/c1-13(2,3)15-12(14)10-9-11-7-5-4-6-8-11;;/h5-10H,1-3H3;1H;/q-1;;+2/p-1/b10-9+;;.
What are the key properties of magnesium;tert-butyl (E)-3-phenylprop-2-enoate;chloride?
magnesium;tert-butyl (E)-3-phenylprop-2-enoate;chloride has a molecular weight of 263.02 g/mol, XLogP of -0.54, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;tert-butyl (E)-3-phenylprop-2-enoate;chloride is sourced from PubChem (CID 126744440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).