About 5-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carbaldehyde
5-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carbaldehyde (PubChem CID 126744521) has the molecular formula C6H5F3N2O
and a molecular weight of 178.11 g/mol. Its IUPAC name is 5-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carbaldehyde.
Molecular Properties
| Compound Name | 5-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carbaldehyde |
| PubChem CID | 126744521 |
| Molecular Formula | C6H5F3N2O |
| Molecular Weight | 178.11 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | 5-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carbaldehyde |
| SMILES | O=Cc1cc(CC(F)(F)F)[nH]n1 |
| InChI | InChI=1S/C6H5F3N2O/c7-6(8,9)2-4-1-5(3-12)11-10-4/h1,3H,2H2,(H,10,11) |
| InChIKey | OPXFNOVWAXAYRA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.11 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carbaldehyde?
The IUPAC name of 5-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carbaldehyde (CID 126744521) is 5-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carbaldehyde.
What is the SMILES notation for 5-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carbaldehyde?
The canonical SMILES for 5-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carbaldehyde is O=Cc1cc(CC(F)(F)F)[nH]n1.
What is the InChIKey of 5-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carbaldehyde?
The InChIKey is OPXFNOVWAXAYRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F3N2O/c7-6(8,9)2-4-1-5(3-12)11-10-4/h1,3H,2H2,(H,10,11).
What are the key properties of 5-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carbaldehyde?
5-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carbaldehyde has a molecular weight of 178.11 g/mol, XLogP of 1.33, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carbaldehyde is sourced from PubChem (CID 126744521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).