About 5-methylpyrazol-1-amine
5-methylpyrazol-1-amine (PubChem CID 12674533) has the molecular formula C4H7N3
and a molecular weight of 97.12 g/mol. Its IUPAC name is 5-methylpyrazol-1-amine.
Molecular Properties
| Compound Name | 5-methylpyrazol-1-amine |
| PubChem CID | 12674533 |
| Molecular Formula | C4H7N3 |
| Molecular Weight | 97.12 g/mol |
| Exact Mass | 97.06 |
| IUPAC Name | 5-methylpyrazol-1-amine |
| SMILES | Cc1ccnn1N |
| InChI | InChI=1S/C4H7N3/c1-4-2-3-6-7(4)5/h2-3H,5H2,1H3 |
| InChIKey | QWQCJKIQMKXMNQ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.12 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methylpyrazol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylpyrazol-1-amine?
The IUPAC name of 5-methylpyrazol-1-amine (CID 12674533) is 5-methylpyrazol-1-amine.
What is the SMILES notation for 5-methylpyrazol-1-amine?
The canonical SMILES for 5-methylpyrazol-1-amine is Cc1ccnn1N.
What is the InChIKey of 5-methylpyrazol-1-amine?
The InChIKey is QWQCJKIQMKXMNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3/c1-4-2-3-6-7(4)5/h2-3H,5H2,1H3.
What are the key properties of 5-methylpyrazol-1-amine?
5-methylpyrazol-1-amine has a molecular weight of 97.12 g/mol, XLogP of -0.09, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylpyrazol-1-amine is sourced from PubChem (CID 12674533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).