About 4,5,6-trimethyl-2,5-dihydrotriazine
4,5,6-trimethyl-2,5-dihydrotriazine (PubChem CID 12674550) has the molecular formula C6H11N3
and a molecular weight of 125.17 g/mol. Its IUPAC name is 4,5,6-trimethyl-2,5-dihydrotriazine.
Molecular Properties
| Compound Name | 4,5,6-trimethyl-2,5-dihydrotriazine |
| PubChem CID | 12674550 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | 4,5,6-trimethyl-2,5-dihydrotriazine |
| SMILES | CC1=NNN=C(C)C1C |
| InChI | InChI=1S/C6H11N3/c1-4-5(2)7-9-8-6(4)3/h4,9H,1-3H3 |
| InChIKey | OXQOMQSRQOUROO-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5,6-trimethyl-2,5-dihydrotriazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5,6-trimethyl-2,5-dihydrotriazine?
The IUPAC name of 4,5,6-trimethyl-2,5-dihydrotriazine (CID 12674550) is 4,5,6-trimethyl-2,5-dihydrotriazine.
What is the SMILES notation for 4,5,6-trimethyl-2,5-dihydrotriazine?
The canonical SMILES for 4,5,6-trimethyl-2,5-dihydrotriazine is CC1=NNN=C(C)C1C.
What is the InChIKey of 4,5,6-trimethyl-2,5-dihydrotriazine?
The InChIKey is OXQOMQSRQOUROO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3/c1-4-5(2)7-9-8-6(4)3/h4,9H,1-3H3.
What are the key properties of 4,5,6-trimethyl-2,5-dihydrotriazine?
4,5,6-trimethyl-2,5-dihydrotriazine has a molecular weight of 125.17 g/mol, XLogP of 0.98, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5,6-trimethyl-2,5-dihydrotriazine is sourced from PubChem (CID 12674550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).