About (Z,3S)-N,2,3-trimethylpent-1-en-1-amine
(Z,3S)-N,2,3-trimethylpent-1-en-1-amine (PubChem CID 126746017) has the molecular formula C8H17N
and a molecular weight of 127.23 g/mol. Its IUPAC name is (Z,3S)-N,2,3-trimethylpent-1-en-1-amine.
Molecular Properties
| Compound Name | (Z,3S)-N,2,3-trimethylpent-1-en-1-amine |
| PubChem CID | 126746017 |
| Molecular Formula | C8H17N |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.14 |
| IUPAC Name | (Z,3S)-N,2,3-trimethylpent-1-en-1-amine |
| SMILES | CC[C@H](C)/C(C)=C\NC |
| InChI | InChI=1S/C8H17N/c1-5-7(2)8(3)6-9-4/h6-7,9H,5H2,1-4H3/b8-6-/t7-/m0/s1 |
| InChIKey | GHYKTLSCJBGHHL-VQKCLUMFSA-N |
| XLogP | 2.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (Z,3S)-N,2,3-trimethylpent-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,3S)-N,2,3-trimethylpent-1-en-1-amine?
The IUPAC name of (Z,3S)-N,2,3-trimethylpent-1-en-1-amine (CID 126746017) is (Z,3S)-N,2,3-trimethylpent-1-en-1-amine.
What is the SMILES notation for (Z,3S)-N,2,3-trimethylpent-1-en-1-amine?
The canonical SMILES for (Z,3S)-N,2,3-trimethylpent-1-en-1-amine is CC[C@H](C)/C(C)=C\NC.
What is the InChIKey of (Z,3S)-N,2,3-trimethylpent-1-en-1-amine?
The InChIKey is GHYKTLSCJBGHHL-VQKCLUMFSA-N. The full InChI is InChI=1S/C8H17N/c1-5-7(2)8(3)6-9-4/h6-7,9H,5H2,1-4H3/b8-6-/t7-/m0/s1.
What are the key properties of (Z,3S)-N,2,3-trimethylpent-1-en-1-amine?
(Z,3S)-N,2,3-trimethylpent-1-en-1-amine has a molecular weight of 127.23 g/mol, XLogP of 2.16, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,3S)-N,2,3-trimethylpent-1-en-1-amine is sourced from PubChem (CID 126746017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).