C10H17N — CID 126746027
3-ethyl-2,4,6-trimethyl-1,2-dihydropyridine (PubChem CID 126746027) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 3-ethyl-2,4,6-trimethyl-1,2-dihydropyridine.
| Compound Name | 3-ethyl-2,4,6-trimethyl-1,2-dihydropyridine |
|---|---|
| PubChem CID | 126746027 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 3-ethyl-2,4,6-trimethyl-1,2-dihydropyridine |
| SMILES | CCC1=C(C)C=C(C)NC1C |
| InChI | InChI=1S/C10H17N/c1-5-10-7(2)6-8(3)11-9(10)4/h6,9,11H,5H2,1-4H3 |
| InChIKey | QATXVQTUTDBHGF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |