About 3,3-dimethylazetidine
3,3-dimethylazetidine (PubChem CID 12674607) has the molecular formula C5H11N
and a molecular weight of 85.15 g/mol. Its IUPAC name is 3,3-dimethylazetidine.
Molecular Properties
| Compound Name | 3,3-dimethylazetidine |
| PubChem CID | 12674607 |
| Molecular Formula | C5H11N |
| Molecular Weight | 85.15 g/mol |
| Exact Mass | 85.09 |
| IUPAC Name | 3,3-dimethylazetidine |
| SMILES | CC1(C)CNC1 |
| InChI | InChI=1S/C5H11N/c1-5(2)3-6-4-5/h6H,3-4H2,1-2H3 |
| InChIKey | RLVVIGIYIMDCAU-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 85.15 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,3-dimethylazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethylazetidine?
The IUPAC name of 3,3-dimethylazetidine (CID 12674607) is 3,3-dimethylazetidine.
What is the SMILES notation for 3,3-dimethylazetidine?
The canonical SMILES for 3,3-dimethylazetidine is CC1(C)CNC1.
What is the InChIKey of 3,3-dimethylazetidine?
The InChIKey is RLVVIGIYIMDCAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N/c1-5(2)3-6-4-5/h6H,3-4H2,1-2H3.
What are the key properties of 3,3-dimethylazetidine?
3,3-dimethylazetidine has a molecular weight of 85.15 g/mol, XLogP of 0.62, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylazetidine is sourced from PubChem (CID 12674607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).