About but-3-yn-2-yl carbonofluoridate
but-3-yn-2-yl carbonofluoridate (PubChem CID 126746139) has the molecular formula C5H5FO2
and a molecular weight of 116.09 g/mol. Its IUPAC name is but-3-yn-2-yl carbonofluoridate.
Molecular Properties
| Compound Name | but-3-yn-2-yl carbonofluoridate |
| PubChem CID | 126746139 |
| Molecular Formula | C5H5FO2 |
| Molecular Weight | 116.09 g/mol |
| Exact Mass | 116.03 |
| IUPAC Name | but-3-yn-2-yl carbonofluoridate |
| SMILES | C#CC(C)OC(=O)F |
| InChI | InChI=1S/C5H5FO2/c1-3-4(2)8-5(6)7/h1,4H,2H3 |
| InChIKey | ZKEFAXICNJXELG-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.09 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze but-3-yn-2-yl carbonofluoridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-yn-2-yl carbonofluoridate?
The IUPAC name of but-3-yn-2-yl carbonofluoridate (CID 126746139) is but-3-yn-2-yl carbonofluoridate.
What is the SMILES notation for but-3-yn-2-yl carbonofluoridate?
The canonical SMILES for but-3-yn-2-yl carbonofluoridate is C#CC(C)OC(=O)F.
What is the InChIKey of but-3-yn-2-yl carbonofluoridate?
The InChIKey is ZKEFAXICNJXELG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5FO2/c1-3-4(2)8-5(6)7/h1,4H,2H3.
What are the key properties of but-3-yn-2-yl carbonofluoridate?
but-3-yn-2-yl carbonofluoridate has a molecular weight of 116.09 g/mol, XLogP of 1.11, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-yn-2-yl carbonofluoridate is sourced from PubChem (CID 126746139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).