About 4-[4-(1,5-dimethylpiperidin-3-yl)butan-2-yl]-2,6-dimethylmorpholine
4-[4-(1,5-dimethylpiperidin-3-yl)butan-2-yl]-2,6-dimethylmorpholine (PubChem CID 126746252) has the molecular formula C17H34N2O
and a molecular weight of 282.47 g/mol. Its IUPAC name is 4-[4-(1,5-dimethylpiperidin-3-yl)butan-2-yl]-2,6-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-[4-(1,5-dimethylpiperidin-3-yl)butan-2-yl]-2,6-dimethylmorpholine |
| PubChem CID | 126746252 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | 4-[4-(1,5-dimethylpiperidin-3-yl)butan-2-yl]-2,6-dimethylmorpholine |
| SMILES | CC1CC(CCC(C)N2CC(C)OC(C)C2)CN(C)C1 |
| InChI | InChI=1S/C17H34N2O/c1-13-8-17(12-18(5)9-13)7-6-14(2)19-10-15(3)20-16(4)11-19/h13-17H,6-12H2,1-5H3 |
| InChIKey | XPJGZOGVXDIJPR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[4-(1,5-dimethylpiperidin-3-yl)butan-2-yl]-2,6-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(1,5-dimethylpiperidin-3-yl)butan-2-yl]-2,6-dimethylmorpholine?
The IUPAC name of 4-[4-(1,5-dimethylpiperidin-3-yl)butan-2-yl]-2,6-dimethylmorpholine (CID 126746252) is 4-[4-(1,5-dimethylpiperidin-3-yl)butan-2-yl]-2,6-dimethylmorpholine.
What is the SMILES notation for 4-[4-(1,5-dimethylpiperidin-3-yl)butan-2-yl]-2,6-dimethylmorpholine?
The canonical SMILES for 4-[4-(1,5-dimethylpiperidin-3-yl)butan-2-yl]-2,6-dimethylmorpholine is CC1CC(CCC(C)N2CC(C)OC(C)C2)CN(C)C1.
What is the InChIKey of 4-[4-(1,5-dimethylpiperidin-3-yl)butan-2-yl]-2,6-dimethylmorpholine?
The InChIKey is XPJGZOGVXDIJPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34N2O/c1-13-8-17(12-18(5)9-13)7-6-14(2)19-10-15(3)20-16(4)11-19/h13-17H,6-12H2,1-5H3.
What are the key properties of 4-[4-(1,5-dimethylpiperidin-3-yl)butan-2-yl]-2,6-dimethylmorpholine?
4-[4-(1,5-dimethylpiperidin-3-yl)butan-2-yl]-2,6-dimethylmorpholine has a molecular weight of 282.47 g/mol, XLogP of 2.85, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(1,5-dimethylpiperidin-3-yl)butan-2-yl]-2,6-dimethylmorpholine is sourced from PubChem (CID 126746252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).