C21H33FO4 — CID 126746300
(4S)-4-[(1S)-5-fluoro-1-[(2R)-3-phenylmethoxybutan-2-yl]oxypentyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 126746300) has the molecular formula C21H33FO4 and a molecular weight of 368.49 g/mol. Its IUPAC name is (4S)-4-[(1S)-5-fluoro-1-[(2R)-3-phenylmethoxybutan-2-yl]oxypentyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4S)-4-[(1S)-5-fluoro-1-[(2R)-3-phenylmethoxybutan-2-yl]oxypentyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 126746300 |
| Molecular Formula | C21H33FO4 |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | (4S)-4-[(1S)-5-fluoro-1-[(2R)-3-phenylmethoxybutan-2-yl]oxypentyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC(OCc1ccccc1)[C@@H](C)O[C@@H](CCCCF)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C21H33FO4/c1-16(23-14-18-10-6-5-7-11-18)17(2)25-19(12-8-9-13-22)20-15-24-21(3,4)26-20/h5-7,10-11,16-17,19-20H,8-9,12-15H2,1-4H3/t16?,17-,19+,20+/m1/s1 |
| InChIKey | LRJCGLWHBKEKRU-KWXCSSEASA-N |
| XLogP | 4.66 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|