C11H13FO2 — CID 126746336
(2S)-6-fluoro-2-[(2S)-oxiran-2-yl]-3,4,4a,8a-tetrahydro-2H-chromene (PubChem CID 126746336) has the molecular formula C11H13FO2 and a molecular weight of 196.22 g/mol. Its IUPAC name is (2S)-6-fluoro-2-[(2S)-oxiran-2-yl]-3,4,4a,8a-tetrahydro-2H-chromene.
| Compound Name | (2S)-6-fluoro-2-[(2S)-oxiran-2-yl]-3,4,4a,8a-tetrahydro-2H-chromene |
|---|---|
| PubChem CID | 126746336 |
| Molecular Formula | C11H13FO2 |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | (2S)-6-fluoro-2-[(2S)-oxiran-2-yl]-3,4,4a,8a-tetrahydro-2H-chromene |
| SMILES | FC1=CC2CC[C@@H]([C@@H]3CO3)OC2C=C1 |
| InChI | InChI=1S/C11H13FO2/c12-8-2-4-9-7(5-8)1-3-10(14-9)11-6-13-11/h2,4-5,7,9-11H,1,3,6H2/t7?,9?,10-,11-/m0/s1 |
| InChIKey | WEEORYFLGXQGLC-MUTHCCDMSA-N |
| XLogP | 1.97 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|