C18H25FO4 — CID 126746381
(2R)-6-butoxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-7-fluoro-3,4-dihydro-2H-chromene (PubChem CID 126746381) has the molecular formula C18H25FO4 and a molecular weight of 324.39 g/mol. Its IUPAC name is (2R)-6-butoxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-7-fluoro-3,4-dihydro-2H-chromene.
| Compound Name | (2R)-6-butoxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-7-fluoro-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 126746381 |
| Molecular Formula | C18H25FO4 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | (2R)-6-butoxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-7-fluoro-3,4-dihydro-2H-chromene |
| SMILES | CCCCOc1cc2c(cc1F)O[C@@H]([C@@H]1COC(C)(C)O1)CC2 |
| InChI | InChI=1S/C18H25FO4/c1-4-5-8-20-16-9-12-6-7-14(22-15(12)10-13(16)19)17-11-21-18(2,3)23-17/h9-10,14,17H,4-8,11H2,1-3H3/t14-,17+/m1/s1 |
| InChIKey | XZGNMZMBDSBWLA-PBHICJAKSA-N |
| XLogP | 3.85 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|