C32H37N6O7P — CID 126746532
ethyl (2S)-2-[[[(2R,3S,4S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-hydroxy-4,5-dimethyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-(1H-indol-3-yl)propanoate (PubChem CID 126746532) has the molecular formula C32H37N6O7P and a molecular weight of 648.66 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3S,4S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-hydroxy-4,5-dimethyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-(1H-indol-3-yl)propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3S,4S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-hydroxy-4,5-dimethyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 126746532 |
| Molecular Formula | C32H37N6O7P |
| Molecular Weight | 648.66 g/mol |
| Exact Mass | 648.25 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3S,4S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-hydroxy-4,5-dimethyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-(1H-indol-3-yl)propanoate |
| SMILES | CCOC(=O)[C@H](Cc1c[nH]c2ccccc12)NP(=O)(OC[C@H]1O[C@@](C)(c2ccc3c(N)ncnn23)[C@@H](C)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C32H37N6O7P/c1-4-42-31(40)25(16-21-17-34-24-13-9-8-12-23(21)24)37-46(41,45-22-10-6-5-7-11-22)43-18-27-29(39)20(2)32(3,44-27)28-15-14-26-30(33)35-19-36-38(26)28/h5-15,17,19-20,25,27,29,34,39H,4,16,18H2,1-3H3,(H,37,41)(H2,33,35,36)/t20-,25-,27+,29-,32+,46?/m0/s1 |
| InChIKey | MFRIPEOMAXIMHT-GNFWXCHESA-N |
| XLogP | 4.37 |
| TPSA | 175.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.66 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|