C66H44N2 — CID 126746545
2-[4-[3-[3,5-di(fluoranthen-3-yl)phenyl]-5-[4-(1,2-dihydropyridin-6-yl)phenyl]phenyl]phenyl]-1,2-dihydropyridine (PubChem CID 126746545) has the molecular formula C66H44N2 and a molecular weight of 865.09 g/mol. Its IUPAC name is 2-[4-[3-[3,5-di(fluoranthen-3-yl)phenyl]-5-[4-(1,2-dihydropyridin-6-yl)phenyl]phenyl]phenyl]-1,2-dihydropyridine.
| Compound Name | 2-[4-[3-[3,5-di(fluoranthen-3-yl)phenyl]-5-[4-(1,2-dihydropyridin-6-yl)phenyl]phenyl]phenyl]-1,2-dihydropyridine |
|---|---|
| PubChem CID | 126746545 |
| Molecular Formula | C66H44N2 |
| Molecular Weight | 865.09 g/mol |
| Exact Mass | 864.35 |
| IUPAC Name | 2-[4-[3-[3,5-di(fluoranthen-3-yl)phenyl]-5-[4-(1,2-dihydropyridin-6-yl)phenyl]phenyl]phenyl]-1,2-dihydropyridine |
| SMILES | C1=CCNC(c2ccc(-c3cc(-c4ccc(C5C=CC=CN5)cc4)cc(-c4cc(-c5ccc6c7c(cccc57)-c5ccccc5-6)cc(-c5ccc6c7c(cccc57)-c5ccccc5-6)c4)c3)cc2)=C1 |
| InChI | InChI=1S/C66H44N2/c1-3-13-55-53(11-1)59-17-9-15-57-51(29-31-61(55)65(57)59)49-38-48(39-50(40-49)52-30-32-62-56-14-4-2-12-54(56)60-18-10-16-58(52)66(60)62)47-36-45(41-21-25-43(26-22-41)63-19-5-7-33-67-63)35-46(37-47)42-23-27-44(28-24-42)64-20-6-8-34-68-64/h1-33,35-40,63,67-68H,34H2 |
| InChIKey | AWBVRTFYVHRMTO-UHFFFAOYSA-N |
| XLogP | 16.84 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.09 |
| LogP ≤ 5 | 16.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |