C13H20N2 — CID 126746716
(4aS,8aR)-2-ethyl-3-[(Z)-prop-1-enyl]-4a,5,6,7,8,8a-hexahydroquinoxaline (PubChem CID 126746716) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is (4aS,8aR)-2-ethyl-3-[(Z)-prop-1-enyl]-4a,5,6,7,8,8a-hexahydroquinoxaline.
| Compound Name | (4aS,8aR)-2-ethyl-3-[(Z)-prop-1-enyl]-4a,5,6,7,8,8a-hexahydroquinoxaline |
|---|---|
| PubChem CID | 126746716 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | (4aS,8aR)-2-ethyl-3-[(Z)-prop-1-enyl]-4a,5,6,7,8,8a-hexahydroquinoxaline |
| SMILES | C/C=C\C1=N[C@H]2CCCC[C@H]2N=C1CC |
| InChI | InChI=1S/C13H20N2/c1-3-7-11-10(4-2)14-12-8-5-6-9-13(12)15-11/h3,7,12-13H,4-6,8-9H2,1-2H3/b7-3-/t12-,13+/m1/s1 |
| InChIKey | YXJKAOUDYYIYBN-KQMXKCMJSA-N |
| XLogP | 3.18 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |