C9H14N2S — CID 126746773
(1Z,3Z)-2-amino-1-[[(1Z)-buta-1,3-dienyl]amino]penta-1,3-diene-1-thiol (PubChem CID 126746773) has the molecular formula C9H14N2S and a molecular weight of 182.29 g/mol. Its IUPAC name is (1Z,3Z)-2-amino-1-[[(1Z)-buta-1,3-dienyl]amino]penta-1,3-diene-1-thiol.
| Compound Name | (1Z,3Z)-2-amino-1-[[(1Z)-buta-1,3-dienyl]amino]penta-1,3-diene-1-thiol |
|---|---|
| PubChem CID | 126746773 |
| Molecular Formula | C9H14N2S |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (1Z,3Z)-2-amino-1-[[(1Z)-buta-1,3-dienyl]amino]penta-1,3-diene-1-thiol |
| SMILES | C=C/C=C\N/C(S)=C(N)\C=C/C |
| InChI | InChI=1S/C9H14N2S/c1-3-5-7-11-9(12)8(10)6-4-2/h3-7,11-12H,1,10H2,2H3/b6-4-,7-5-,9-8- |
| InChIKey | QMGCFESMMUCXAZ-WRQXQGDDSA-N |
| XLogP | 1.91 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|