C13H21FN4 — CID 126746813
N'-[(1E,3Z)-1-[[(1E)-2-fluorobuta-1,3-dienyl]amino]-1-(methylamino)hexa-1,3-dien-2-yl]ethanimidamide (PubChem CID 126746813) has the molecular formula C13H21FN4 and a molecular weight of 252.34 g/mol. Its IUPAC name is N'-[(1E,3Z)-1-[[(1E)-2-fluorobuta-1,3-dienyl]amino]-1-(methylamino)hexa-1,3-dien-2-yl]ethanimidamide.
| Compound Name | N'-[(1E,3Z)-1-[[(1E)-2-fluorobuta-1,3-dienyl]amino]-1-(methylamino)hexa-1,3-dien-2-yl]ethanimidamide |
|---|---|
| PubChem CID | 126746813 |
| Molecular Formula | C13H21FN4 |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | N'-[(1E,3Z)-1-[[(1E)-2-fluorobuta-1,3-dienyl]amino]-1-(methylamino)hexa-1,3-dien-2-yl]ethanimidamide |
| SMILES | C=C/C(F)=C\N/C(NC)=C(\C=C/CC)/N=C(\C)N |
| InChI | InChI=1S/C13H21FN4/c1-5-7-8-12(18-10(3)15)13(16-4)17-9-11(14)6-2/h6-9,16-17H,2,5H2,1,3-4H3,(H2,15,18)/b8-7-,11-9+,13-12+ |
| InChIKey | IJJBDYXHNQXSQC-WICNSLBASA-N |
| XLogP | 2.30 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|