C21H19F3N2O2 — CID 126746834
4-[5-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]naphthalene-1-carboxamide (PubChem CID 126746834) has the molecular formula C21H19F3N2O2 and a molecular weight of 388.39 g/mol. Its IUPAC name is 4-[5-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]naphthalene-1-carboxamide.
| Compound Name | 4-[5-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 126746834 |
| Molecular Formula | C21H19F3N2O2 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 4-[5-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]naphthalene-1-carboxamide |
| SMILES | C/C=C\C(=C/C)C1(C(F)(F)F)CC(c2ccc(C(N)=O)c3ccccc23)=NO1 |
| InChI | InChI=1S/C21H19F3N2O2/c1-3-7-13(4-2)20(21(22,23)24)12-18(26-28-20)16-10-11-17(19(25)27)15-9-6-5-8-14(15)16/h3-11H,12H2,1-2H3,(H2,25,27)/b7-3-,13-4+ |
| InChIKey | CFSXFEKRDFJLSO-UWNVVLRYSA-N |
| XLogP | 4.89 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|