About (Z)-[(E)-4,5,5-trimethylhex-3-en-2-ylidene]hydrazine
(Z)-[(E)-4,5,5-trimethylhex-3-en-2-ylidene]hydrazine (PubChem CID 126746974) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is (Z)-[(E)-4,5,5-trimethylhex-3-en-2-ylidene]hydrazine.
Molecular Properties
| Compound Name | (Z)-[(E)-4,5,5-trimethylhex-3-en-2-ylidene]hydrazine |
| PubChem CID | 126746974 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (Z)-[(E)-4,5,5-trimethylhex-3-en-2-ylidene]hydrazine |
| SMILES | CC(/C=C(\C)C(C)(C)C)=N/N |
| InChI | InChI=1S/C9H18N2/c1-7(9(3,4)5)6-8(2)11-10/h6H,10H2,1-5H3/b7-6+,11-8- |
| InChIKey | UDMXXBRTWQZGSP-VEQVDCDKSA-N |
| XLogP | 2.31 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-[(E)-4,5,5-trimethylhex-3-en-2-ylidene]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-[(E)-4,5,5-trimethylhex-3-en-2-ylidene]hydrazine?
The IUPAC name of (Z)-[(E)-4,5,5-trimethylhex-3-en-2-ylidene]hydrazine (CID 126746974) is (Z)-[(E)-4,5,5-trimethylhex-3-en-2-ylidene]hydrazine.
What is the SMILES notation for (Z)-[(E)-4,5,5-trimethylhex-3-en-2-ylidene]hydrazine?
The canonical SMILES for (Z)-[(E)-4,5,5-trimethylhex-3-en-2-ylidene]hydrazine is CC(/C=C(\C)C(C)(C)C)=N/N.
What is the InChIKey of (Z)-[(E)-4,5,5-trimethylhex-3-en-2-ylidene]hydrazine?
The InChIKey is UDMXXBRTWQZGSP-VEQVDCDKSA-N. The full InChI is InChI=1S/C9H18N2/c1-7(9(3,4)5)6-8(2)11-10/h6H,10H2,1-5H3/b7-6+,11-8-.
What are the key properties of (Z)-[(E)-4,5,5-trimethylhex-3-en-2-ylidene]hydrazine?
(Z)-[(E)-4,5,5-trimethylhex-3-en-2-ylidene]hydrazine has a molecular weight of 154.26 g/mol, XLogP of 2.31, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-[(E)-4,5,5-trimethylhex-3-en-2-ylidene]hydrazine is sourced from PubChem (CID 126746974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).