About 2-(2-fluoro-6-methyl-1,2-dihydropyridin-3-yl)propan-2-ol
2-(2-fluoro-6-methyl-1,2-dihydropyridin-3-yl)propan-2-ol (PubChem CID 126747591) has the molecular formula C9H14FNO
and a molecular weight of 171.22 g/mol. Its IUPAC name is 2-(2-fluoro-6-methyl-1,2-dihydropyridin-3-yl)propan-2-ol.
Molecular Properties
| Compound Name | 2-(2-fluoro-6-methyl-1,2-dihydropyridin-3-yl)propan-2-ol |
| PubChem CID | 126747591 |
| Molecular Formula | C9H14FNO |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 2-(2-fluoro-6-methyl-1,2-dihydropyridin-3-yl)propan-2-ol |
| SMILES | CC1=CC=C(C(C)(C)O)C(F)N1 |
| InChI | InChI=1S/C9H14FNO/c1-6-4-5-7(8(10)11-6)9(2,3)12/h4-5,8,11-12H,1-3H3 |
| InChIKey | JWLLYURTHKHWFQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-fluoro-6-methyl-1,2-dihydropyridin-3-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluoro-6-methyl-1,2-dihydropyridin-3-yl)propan-2-ol?
The IUPAC name of 2-(2-fluoro-6-methyl-1,2-dihydropyridin-3-yl)propan-2-ol (CID 126747591) is 2-(2-fluoro-6-methyl-1,2-dihydropyridin-3-yl)propan-2-ol.
What is the SMILES notation for 2-(2-fluoro-6-methyl-1,2-dihydropyridin-3-yl)propan-2-ol?
The canonical SMILES for 2-(2-fluoro-6-methyl-1,2-dihydropyridin-3-yl)propan-2-ol is CC1=CC=C(C(C)(C)O)C(F)N1.
What is the InChIKey of 2-(2-fluoro-6-methyl-1,2-dihydropyridin-3-yl)propan-2-ol?
The InChIKey is JWLLYURTHKHWFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14FNO/c1-6-4-5-7(8(10)11-6)9(2,3)12/h4-5,8,11-12H,1-3H3.
What are the key properties of 2-(2-fluoro-6-methyl-1,2-dihydropyridin-3-yl)propan-2-ol?
2-(2-fluoro-6-methyl-1,2-dihydropyridin-3-yl)propan-2-ol has a molecular weight of 171.22 g/mol, XLogP of 1.49, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluoro-6-methyl-1,2-dihydropyridin-3-yl)propan-2-ol is sourced from PubChem (CID 126747591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).