About 3-amino-N,4-dimethyl-N-[1-[[(3R)-3-methyl-1-oxopentan-2-yl]amino]propan-2-yl]hexanamide
3-amino-N,4-dimethyl-N-[1-[[(3R)-3-methyl-1-oxopentan-2-yl]amino]propan-2-yl]hexanamide (PubChem CID 126747616) has the molecular formula C17H35N3O2
and a molecular weight of 313.49 g/mol. Its IUPAC name is 3-amino-N,4-dimethyl-N-[1-[[(3R)-3-methyl-1-oxopentan-2-yl]amino]propan-2-yl]hexanamide.
Molecular Properties
| Compound Name | 3-amino-N,4-dimethyl-N-[1-[[(3R)-3-methyl-1-oxopentan-2-yl]amino]propan-2-yl]hexanamide |
| PubChem CID | 126747616 |
| Molecular Formula | C17H35N3O2 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.27 |
| IUPAC Name | 3-amino-N,4-dimethyl-N-[1-[[(3R)-3-methyl-1-oxopentan-2-yl]amino]propan-2-yl]hexanamide |
| SMILES | CCC(C)C(N)CC(=O)N(C)C(C)CNC(C=O)[C@H](C)CC |
| InChI | InChI=1S/C17H35N3O2/c1-7-12(3)15(18)9-17(22)20(6)14(5)10-19-16(11-21)13(4)8-2/h11-16,19H,7-10,18H2,1-6H3/t12?,13-,14?,15?,16?/m1/s1 |
| InChIKey | HRWRCXMEEZELJA-MJDLKMQVSA-N |
| XLogP | 1.80 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N,4-dimethyl-N-[1-[[(3R)-3-methyl-1-oxopentan-2-yl]amino]propan-2-yl]hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N,4-dimethyl-N-[1-[[(3R)-3-methyl-1-oxopentan-2-yl]amino]propan-2-yl]hexanamide?
The IUPAC name of 3-amino-N,4-dimethyl-N-[1-[[(3R)-3-methyl-1-oxopentan-2-yl]amino]propan-2-yl]hexanamide (CID 126747616) is 3-amino-N,4-dimethyl-N-[1-[[(3R)-3-methyl-1-oxopentan-2-yl]amino]propan-2-yl]hexanamide.
What is the SMILES notation for 3-amino-N,4-dimethyl-N-[1-[[(3R)-3-methyl-1-oxopentan-2-yl]amino]propan-2-yl]hexanamide?
The canonical SMILES for 3-amino-N,4-dimethyl-N-[1-[[(3R)-3-methyl-1-oxopentan-2-yl]amino]propan-2-yl]hexanamide is CCC(C)C(N)CC(=O)N(C)C(C)CNC(C=O)[C@H](C)CC.
What is the InChIKey of 3-amino-N,4-dimethyl-N-[1-[[(3R)-3-methyl-1-oxopentan-2-yl]amino]propan-2-yl]hexanamide?
The InChIKey is HRWRCXMEEZELJA-MJDLKMQVSA-N. The full InChI is InChI=1S/C17H35N3O2/c1-7-12(3)15(18)9-17(22)20(6)14(5)10-19-16(11-21)13(4)8-2/h11-16,19H,7-10,18H2,1-6H3/t12?,13-,14?,15?,16?/m1/s1.
What are the key properties of 3-amino-N,4-dimethyl-N-[1-[[(3R)-3-methyl-1-oxopentan-2-yl]amino]propan-2-yl]hexanamide?
3-amino-N,4-dimethyl-N-[1-[[(3R)-3-methyl-1-oxopentan-2-yl]amino]propan-2-yl]hexanamide has a molecular weight of 313.49 g/mol, XLogP of 1.80, 11 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N,4-dimethyl-N-[1-[[(3R)-3-methyl-1-oxopentan-2-yl]amino]propan-2-yl]hexanamide is sourced from PubChem (CID 126747616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).