C25H29ClN10O — CID 126747680
N-amino-N-[1-[[6-[[7-(3-chloro-4-cyanophenyl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]amino]-3-pyridinyl]oxy]-2-methylpropan-2-yl]-N'-(methylamino)methanimidamide (PubChem CID 126747680) has the molecular formula C25H29ClN10O and a molecular weight of 521.03 g/mol. Its IUPAC name is N-amino-N-[1-[[6-[[7-(3-chloro-4-cyanophenyl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]amino]-3-pyridinyl]oxy]-2-methylpropan-2-yl]-N'-(methylamino)methanimidamide.
| Compound Name | N-amino-N-[1-[[6-[[7-(3-chloro-4-cyanophenyl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]amino]-3-pyridinyl]oxy]-2-methylpropan-2-yl]-N'-(methylamino)methanimidamide |
|---|---|
| PubChem CID | 126747680 |
| Molecular Formula | C25H29ClN10O |
| Molecular Weight | 521.03 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | N-amino-N-[1-[[6-[[7-(3-chloro-4-cyanophenyl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]amino]-3-pyridinyl]oxy]-2-methylpropan-2-yl]-N'-(methylamino)methanimidamide |
| SMILES | CN/N=C\N(N)C(C)(C)COc1ccc(Nc2ncnc3c2CCN(c2ccc(C#N)c(Cl)c2)C3)nc1 |
| InChI | InChI=1S/C25H29ClN10O/c1-25(2,36(28)16-33-29-3)14-37-19-6-7-23(30-12-19)34-24-20-8-9-35(13-22(20)31-15-32-24)18-5-4-17(11-27)21(26)10-18/h4-7,10,12,15-16,29H,8-9,13-14,28H2,1-3H3,(H,30,31,32,34)/b33-16- |
| InChIKey | JSVCQJSKMCDVNC-BJUCDSOZSA-N |
| XLogP | 3.20 |
| TPSA | 140.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.03 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|