C16H28S — CID 126748142
3,4,6,7-tetramethyl-1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzothiophene (PubChem CID 126748142) has the molecular formula C16H28S and a molecular weight of 252.47 g/mol. Its IUPAC name is 3,4,6,7-tetramethyl-1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzothiophene.
| Compound Name | 3,4,6,7-tetramethyl-1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzothiophene |
|---|---|
| PubChem CID | 126748142 |
| Molecular Formula | C16H28S |
| Molecular Weight | 252.47 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | 3,4,6,7-tetramethyl-1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzothiophene |
| SMILES | CC1CCC2C3CCC(C)C(C)C3SC2C1C |
| InChI | InChI=1S/C16H28S/c1-9-5-7-13-14-8-6-10(2)12(4)16(14)17-15(13)11(9)3/h9-16H,5-8H2,1-4H3 |
| InChIKey | TVMJFKBZZURKGV-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.47 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |