C15H22O2 — CID 126748703
5-but-3-enyl-1,2-bis(methoxymethyl)cyclohepta-1,3,5-triene (PubChem CID 126748703) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 5-but-3-enyl-1,2-bis(methoxymethyl)cyclohepta-1,3,5-triene.
| Compound Name | 5-but-3-enyl-1,2-bis(methoxymethyl)cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 126748703 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 5-but-3-enyl-1,2-bis(methoxymethyl)cyclohepta-1,3,5-triene |
| SMILES | C=CCCC1=CCC(COC)=C(COC)C=C1 |
| InChI | InChI=1S/C15H22O2/c1-4-5-6-13-7-9-14(11-16-2)15(10-8-13)12-17-3/h4,7-9H,1,5-6,10-12H2,2-3H3 |
| InChIKey | IAEBUFFUAZTPOP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|