C34H39N2+ — CID 126749004
7,10,10,18,18-pentamethyl-14-phenyl-7-aza-21-azoniahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-1,4,6(11),12,14,16,21(25)-heptaene (PubChem CID 126749004) has the molecular formula C34H39N2+ and a molecular weight of 475.70 g/mol. Its IUPAC name is 7,10,10,18,18-pentamethyl-14-phenyl-7-aza-21-azoniahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-1,4,6(11),12,14,16,21(25)-heptaene.
| Compound Name | 7,10,10,18,18-pentamethyl-14-phenyl-7-aza-21-azoniahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-1,4,6(11),12,14,16,21(25)-heptaene |
|---|---|
| PubChem CID | 126749004 |
| Molecular Formula | C34H39N2+ |
| Molecular Weight | 475.70 g/mol |
| Exact Mass | 475.31 |
| IUPAC Name | 7,10,10,18,18-pentamethyl-14-phenyl-7-aza-21-azoniahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-1,4,6(11),12,14,16,21(25)-heptaene |
| SMILES | CN1CCC(C)(C)c2cc3c(cc21)Cc1c2c4c(cc1=C3c1ccccc1)C(C)(C)CC[N+]=4CCC2 |
| InChI | InChI=1S/C34H39N2/c1-33(2)13-16-35(5)30-19-23-18-26-24-12-9-15-36-17-14-34(3,4)29(32(24)36)21-27(26)31(25(23)20-28(30)33)22-10-7-6-8-11-22/h6-8,10-11,19-21H,9,12-18H2,1-5H3/q+1 |
| InChIKey | XKGMTQFIELVZKH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.70 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|