C32H37N2+ — CID 126749009
6,9,9,17,17,20-hexamethyl-13-phenyl-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5,10,12,14,16(21)-heptaene (PubChem CID 126749009) has the molecular formula C32H37N2+ and a molecular weight of 449.66 g/mol. Its IUPAC name is 6,9,9,17,17,20-hexamethyl-13-phenyl-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5,10,12,14,16(21)-heptaene.
| Compound Name | 6,9,9,17,17,20-hexamethyl-13-phenyl-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5,10,12,14,16(21)-heptaene |
|---|---|
| PubChem CID | 126749009 |
| Molecular Formula | C32H37N2+ |
| Molecular Weight | 449.66 g/mol |
| Exact Mass | 449.30 |
| IUPAC Name | 6,9,9,17,17,20-hexamethyl-13-phenyl-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5,10,12,14,16(21)-heptaene |
| SMILES | CN1CCC(C)(C)c2cc3c(cc21)Cc1cc2c(cc1=C3c1ccccc1)C(C)(C)CC[N+]=2C |
| InChI | InChI=1S/C32H37N2/c1-31(2)12-14-33(5)28-17-22-16-23-18-29-27(32(3,4)13-15-34(29)6)20-25(23)30(24(22)19-26(28)31)21-10-8-7-9-11-21/h7-11,17-20H,12-16H2,1-6H3/q+1 |
| InChIKey | OKUVGGROWYXTIO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.66 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|