About N,N'-dibenzyl-1,2-diphenylethane-1,2-diimine
N,N'-dibenzyl-1,2-diphenylethane-1,2-diimine (PubChem CID 12674936) has the molecular formula C28H24N2
and a molecular weight of 388.51 g/mol. Its IUPAC name is N,N'-dibenzyl-1,2-diphenylethane-1,2-diimine.
Molecular Properties
| Compound Name | N,N'-dibenzyl-1,2-diphenylethane-1,2-diimine |
| PubChem CID | 12674936 |
| Molecular Formula | C28H24N2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | N,N'-dibenzyl-1,2-diphenylethane-1,2-diimine |
| SMILES | c1ccc(C/N=C(C(=N/Cc2ccccc2)/c2ccccc2)\c2ccccc2)cc1 |
| InChI | InChI=1S/C28H24N2/c1-5-13-23(14-6-1)21-29-27(25-17-9-3-10-18-25)28(26-19-11-4-12-20-26)30-22-24-15-7-2-8-16-24/h1-20H,21-22H2/b29-27+,30-28+ |
| InChIKey | BRTDCJAZAKPVQS-QAVVBOBSSA-N |
| XLogP | 6.37 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,N'-dibenzyl-1,2-diphenylethane-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-dibenzyl-1,2-diphenylethane-1,2-diimine?
The IUPAC name of N,N'-dibenzyl-1,2-diphenylethane-1,2-diimine (CID 12674936) is N,N'-dibenzyl-1,2-diphenylethane-1,2-diimine.
What is the SMILES notation for N,N'-dibenzyl-1,2-diphenylethane-1,2-diimine?
The canonical SMILES for N,N'-dibenzyl-1,2-diphenylethane-1,2-diimine is c1ccc(C/N=C(C(=N/Cc2ccccc2)/c2ccccc2)\c2ccccc2)cc1.
What is the InChIKey of N,N'-dibenzyl-1,2-diphenylethane-1,2-diimine?
The InChIKey is BRTDCJAZAKPVQS-QAVVBOBSSA-N. The full InChI is InChI=1S/C28H24N2/c1-5-13-23(14-6-1)21-29-27(25-17-9-3-10-18-25)28(26-19-11-4-12-20-26)30-22-24-15-7-2-8-16-24/h1-20H,21-22H2/b29-27+,30-28+.
What are the key properties of N,N'-dibenzyl-1,2-diphenylethane-1,2-diimine?
N,N'-dibenzyl-1,2-diphenylethane-1,2-diimine has a molecular weight of 388.51 g/mol, XLogP of 6.37, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-dibenzyl-1,2-diphenylethane-1,2-diimine is sourced from PubChem (CID 12674936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).