C22H34O4 — CID 126749501
propan-2-yl 3-acetyloxy-3-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)propanoate (PubChem CID 126749501) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is propan-2-yl 3-acetyloxy-3-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)propanoate.
| Compound Name | propan-2-yl 3-acetyloxy-3-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)propanoate |
|---|---|
| PubChem CID | 126749501 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | propan-2-yl 3-acetyloxy-3-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)propanoate |
| SMILES | CC(=O)OC(CC(=O)OC(C)C)C1CC2CC1C1C3CC(C(C)C3C)C21 |
| InChI | InChI=1S/C22H34O4/c1-10(2)25-20(24)9-19(26-13(5)23)17-6-14-7-18(17)22-16-8-15(21(14)22)11(3)12(16)4/h10-12,14-19,21-22H,6-9H2,1-5H3 |
| InChIKey | ICCDPXPPOLCIMF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|