2,4,5-trifluorothiophene-3-sulfonic acid

C4HF3O3S2 — CID 126749973

IUPAC2,4,5-trifluorothiophene-3-sulfonic acid
SMILESO=S(=O)(O)c1c(F)sc(F)c1F
InChIInChI=1S/C4HF3O3S2/c5-1-2(12(8,9)10)4(7)11-3(1)6/h(H,8,9,10)
InChIKeyJDIIKBMHBMFAII-UHFFFAOYSA-N
MW218.18 g/mol
LogP1.41
Rot. Bonds1

About 2,4,5-trifluorothiophene-3-sulfonic acid

2,4,5-trifluorothiophene-3-sulfonic acid (PubChem CID 126749973) has the molecular formula C4HF3O3S2 and a molecular weight of 218.18 g/mol. Its IUPAC name is 2,4,5-trifluorothiophene-3-sulfonic acid.

Molecular Properties

Compound Name2,4,5-trifluorothiophene-3-sulfonic acid
PubChem CID126749973
Molecular FormulaC4HF3O3S2
Molecular Weight218.18 g/mol
Exact Mass217.93
IUPAC Name2,4,5-trifluorothiophene-3-sulfonic acid
SMILESO=S(=O)(O)c1c(F)sc(F)c1F
InChIInChI=1S/C4HF3O3S2/c5-1-2(12(8,9)10)4(7)11-3(1)6/h(H,8,9,10)
InChIKeyJDIIKBMHBMFAII-UHFFFAOYSA-N
XLogP1.41
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.18
LogP ≤ 51.41
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2,4,5-trifluorothiophene-3-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4,5-trifluorothiophene-3-sulfonic acid?
The IUPAC name of 2,4,5-trifluorothiophene-3-sulfonic acid (CID 126749973) is 2,4,5-trifluorothiophene-3-sulfonic acid.
What is the SMILES notation for 2,4,5-trifluorothiophene-3-sulfonic acid?
The canonical SMILES for 2,4,5-trifluorothiophene-3-sulfonic acid is O=S(=O)(O)c1c(F)sc(F)c1F.
What is the InChIKey of 2,4,5-trifluorothiophene-3-sulfonic acid?
The InChIKey is JDIIKBMHBMFAII-UHFFFAOYSA-N. The full InChI is InChI=1S/C4HF3O3S2/c5-1-2(12(8,9)10)4(7)11-3(1)6/h(H,8,9,10).
What are the key properties of 2,4,5-trifluorothiophene-3-sulfonic acid?
2,4,5-trifluorothiophene-3-sulfonic acid has a molecular weight of 218.18 g/mol, XLogP of 1.41, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,5-trifluorothiophene-3-sulfonic acid is sourced from PubChem (CID 126749973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).