About 3,5-difluorothiophene-2,4-disulfonic acid
3,5-difluorothiophene-2,4-disulfonic acid (PubChem CID 126750021) has the molecular formula C4H2F2O6S3
and a molecular weight of 280.25 g/mol. Its IUPAC name is 3,5-difluorothiophene-2,4-disulfonic acid.
Molecular Properties
| Compound Name | 3,5-difluorothiophene-2,4-disulfonic acid |
| PubChem CID | 126750021 |
| Molecular Formula | C4H2F2O6S3 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 279.90 |
| IUPAC Name | 3,5-difluorothiophene-2,4-disulfonic acid |
| SMILES | O=S(=O)(O)c1sc(F)c(S(=O)(=O)O)c1F |
| InChI | InChI=1S/C4H2F2O6S3/c5-1-2(14(7,8)9)3(6)13-4(1)15(10,11)12/h(H,7,8,9)(H,10,11,12) |
| InChIKey | IZSFHSLHMJAPOI-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3,5-difluorothiophene-2,4-disulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-difluorothiophene-2,4-disulfonic acid?
The IUPAC name of 3,5-difluorothiophene-2,4-disulfonic acid (CID 126750021) is 3,5-difluorothiophene-2,4-disulfonic acid.
What is the SMILES notation for 3,5-difluorothiophene-2,4-disulfonic acid?
The canonical SMILES for 3,5-difluorothiophene-2,4-disulfonic acid is O=S(=O)(O)c1sc(F)c(S(=O)(=O)O)c1F.
What is the InChIKey of 3,5-difluorothiophene-2,4-disulfonic acid?
The InChIKey is IZSFHSLHMJAPOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2F2O6S3/c5-1-2(14(7,8)9)3(6)13-4(1)15(10,11)12/h(H,7,8,9)(H,10,11,12).
What are the key properties of 3,5-difluorothiophene-2,4-disulfonic acid?
3,5-difluorothiophene-2,4-disulfonic acid has a molecular weight of 280.25 g/mol, XLogP of 0.52, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-difluorothiophene-2,4-disulfonic acid is sourced from PubChem (CID 126750021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).