3,5-difluorothiophene-2,4-disulfonic acid

C4H2F2O6S3 — CID 126750021

IUPAC3,5-difluorothiophene-2,4-disulfonic acid
SMILESO=S(=O)(O)c1sc(F)c(S(=O)(=O)O)c1F
InChIInChI=1S/C4H2F2O6S3/c5-1-2(14(7,8)9)3(6)13-4(1)15(10,11)12/h(H,7,8,9)(H,10,11,12)
InChIKeyIZSFHSLHMJAPOI-UHFFFAOYSA-N
MW280.25 g/mol
LogP0.52
Rot. Bonds2

About 3,5-difluorothiophene-2,4-disulfonic acid

3,5-difluorothiophene-2,4-disulfonic acid (PubChem CID 126750021) has the molecular formula C4H2F2O6S3 and a molecular weight of 280.25 g/mol. Its IUPAC name is 3,5-difluorothiophene-2,4-disulfonic acid.

Molecular Properties

Compound Name3,5-difluorothiophene-2,4-disulfonic acid
PubChem CID126750021
Molecular FormulaC4H2F2O6S3
Molecular Weight280.25 g/mol
Exact Mass279.90
IUPAC Name3,5-difluorothiophene-2,4-disulfonic acid
SMILESO=S(=O)(O)c1sc(F)c(S(=O)(=O)O)c1F
InChIInChI=1S/C4H2F2O6S3/c5-1-2(14(7,8)9)3(6)13-4(1)15(10,11)12/h(H,7,8,9)(H,10,11,12)
InChIKeyIZSFHSLHMJAPOI-UHFFFAOYSA-N
XLogP0.52
TPSA108.74 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.25
LogP ≤ 50.52
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 3,5-difluorothiophene-2,4-disulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-difluorothiophene-2,4-disulfonic acid?
The IUPAC name of 3,5-difluorothiophene-2,4-disulfonic acid (CID 126750021) is 3,5-difluorothiophene-2,4-disulfonic acid.
What is the SMILES notation for 3,5-difluorothiophene-2,4-disulfonic acid?
The canonical SMILES for 3,5-difluorothiophene-2,4-disulfonic acid is O=S(=O)(O)c1sc(F)c(S(=O)(=O)O)c1F.
What is the InChIKey of 3,5-difluorothiophene-2,4-disulfonic acid?
The InChIKey is IZSFHSLHMJAPOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2F2O6S3/c5-1-2(14(7,8)9)3(6)13-4(1)15(10,11)12/h(H,7,8,9)(H,10,11,12).
What are the key properties of 3,5-difluorothiophene-2,4-disulfonic acid?
3,5-difluorothiophene-2,4-disulfonic acid has a molecular weight of 280.25 g/mol, XLogP of 0.52, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-difluorothiophene-2,4-disulfonic acid is sourced from PubChem (CID 126750021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).