C13H20F3NO — CID 126750241
2,2-dimethyl-1-[4-(3,3,3-trifluoroprop-1-en-2-yl)piperidin-1-yl]propan-1-one (PubChem CID 126750241) has the molecular formula C13H20F3NO and a molecular weight of 263.30 g/mol. Its IUPAC name is 2,2-dimethyl-1-[4-(3,3,3-trifluoroprop-1-en-2-yl)piperidin-1-yl]propan-1-one.
| Compound Name | 2,2-dimethyl-1-[4-(3,3,3-trifluoroprop-1-en-2-yl)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 126750241 |
| Molecular Formula | C13H20F3NO |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 2,2-dimethyl-1-[4-(3,3,3-trifluoroprop-1-en-2-yl)piperidin-1-yl]propan-1-one |
| SMILES | C=C(C1CCN(C(=O)C(C)(C)C)CC1)C(F)(F)F |
| InChI | InChI=1S/C13H20F3NO/c1-9(13(14,15)16)10-5-7-17(8-6-10)11(18)12(2,3)4/h10H,1,5-8H2,2-4H3 |
| InChIKey | XRIMCJBEQAFJJO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|