C15H22F3NO — CID 126750258
2,2-dimethyl-1-[9-(2,2,2-trifluoroethylidene)-3-azabicyclo[3.3.1]nonan-3-yl]propan-1-one (PubChem CID 126750258) has the molecular formula C15H22F3NO and a molecular weight of 289.34 g/mol. Its IUPAC name is 2,2-dimethyl-1-[9-(2,2,2-trifluoroethylidene)-3-azabicyclo[3.3.1]nonan-3-yl]propan-1-one.
| Compound Name | 2,2-dimethyl-1-[9-(2,2,2-trifluoroethylidene)-3-azabicyclo[3.3.1]nonan-3-yl]propan-1-one |
|---|---|
| PubChem CID | 126750258 |
| Molecular Formula | C15H22F3NO |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 2,2-dimethyl-1-[9-(2,2,2-trifluoroethylidene)-3-azabicyclo[3.3.1]nonan-3-yl]propan-1-one |
| SMILES | CC(C)(C)C(=O)N1CC2CCCC(C1)C2=CC(F)(F)F |
| InChI | InChI=1S/C15H22F3NO/c1-14(2,3)13(20)19-8-10-5-4-6-11(9-19)12(10)7-15(16,17)18/h7,10-11H,4-6,8-9H2,1-3H3 |
| InChIKey | VWGBCXNVJUQSKX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|