About 1-(6,6-difluoro-3-azabicyclo[3.1.1]heptan-3-yl)-2,2-dimethylpropan-1-one
1-(6,6-difluoro-3-azabicyclo[3.1.1]heptan-3-yl)-2,2-dimethylpropan-1-one (PubChem CID 126750380) has the molecular formula C11H17F2NO
and a molecular weight of 217.26 g/mol. Its IUPAC name is 1-(6,6-difluoro-3-azabicyclo[3.1.1]heptan-3-yl)-2,2-dimethylpropan-1-one.
Molecular Properties
| Compound Name | 1-(6,6-difluoro-3-azabicyclo[3.1.1]heptan-3-yl)-2,2-dimethylpropan-1-one |
| PubChem CID | 126750380 |
| Molecular Formula | C11H17F2NO |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 1-(6,6-difluoro-3-azabicyclo[3.1.1]heptan-3-yl)-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)N1CC2CC(C1)C2(F)F |
| InChI | InChI=1S/C11H17F2NO/c1-10(2,3)9(15)14-5-7-4-8(6-14)11(7,12)13/h7-8H,4-6H2,1-3H3 |
| InChIKey | QVKMMSUFVKSYMJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(6,6-difluoro-3-azabicyclo[3.1.1]heptan-3-yl)-2,2-dimethylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6,6-difluoro-3-azabicyclo[3.1.1]heptan-3-yl)-2,2-dimethylpropan-1-one?
The IUPAC name of 1-(6,6-difluoro-3-azabicyclo[3.1.1]heptan-3-yl)-2,2-dimethylpropan-1-one (CID 126750380) is 1-(6,6-difluoro-3-azabicyclo[3.1.1]heptan-3-yl)-2,2-dimethylpropan-1-one.
What is the SMILES notation for 1-(6,6-difluoro-3-azabicyclo[3.1.1]heptan-3-yl)-2,2-dimethylpropan-1-one?
The canonical SMILES for 1-(6,6-difluoro-3-azabicyclo[3.1.1]heptan-3-yl)-2,2-dimethylpropan-1-one is CC(C)(C)C(=O)N1CC2CC(C1)C2(F)F.
What is the InChIKey of 1-(6,6-difluoro-3-azabicyclo[3.1.1]heptan-3-yl)-2,2-dimethylpropan-1-one?
The InChIKey is QVKMMSUFVKSYMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F2NO/c1-10(2,3)9(15)14-5-7-4-8(6-14)11(7,12)13/h7-8H,4-6H2,1-3H3.
What are the key properties of 1-(6,6-difluoro-3-azabicyclo[3.1.1]heptan-3-yl)-2,2-dimethylpropan-1-one?
1-(6,6-difluoro-3-azabicyclo[3.1.1]heptan-3-yl)-2,2-dimethylpropan-1-one has a molecular weight of 217.26 g/mol, XLogP of 2.15, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6,6-difluoro-3-azabicyclo[3.1.1]heptan-3-yl)-2,2-dimethylpropan-1-one is sourced from PubChem (CID 126750380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).