C18H27F3N2 — CID 126750716
1-[(3Z,5E)-7,7,7-trifluoro-6-methyl-3-piperidin-4-ylhepta-1,3,5-trien-2-yl]piperidine (PubChem CID 126750716) has the molecular formula C18H27F3N2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 1-[(3Z,5E)-7,7,7-trifluoro-6-methyl-3-piperidin-4-ylhepta-1,3,5-trien-2-yl]piperidine.
| Compound Name | 1-[(3Z,5E)-7,7,7-trifluoro-6-methyl-3-piperidin-4-ylhepta-1,3,5-trien-2-yl]piperidine |
|---|---|
| PubChem CID | 126750716 |
| Molecular Formula | C18H27F3N2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | 1-[(3Z,5E)-7,7,7-trifluoro-6-methyl-3-piperidin-4-ylhepta-1,3,5-trien-2-yl]piperidine |
| SMILES | C=C(/C(=C\C=C(/C)C(F)(F)F)C1CCNCC1)N1CCCCC1 |
| InChI | InChI=1S/C18H27F3N2/c1-14(18(19,20)21)6-7-17(16-8-10-22-11-9-16)15(2)23-12-4-3-5-13-23/h6-7,16,22H,2-5,8-13H2,1H3/b14-6+,17-7+ |
| InChIKey | CETFRXBWZHTASA-MJGKAJSHSA-N |
| XLogP | 4.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|