C18H18ClN7O2 — CID 126752228
3-[[3-[2-(4-chlorophenyl)ethyl]-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-7-(methylamino)imidazo[5,1-f][1,2,4]triazin-4-one (PubChem CID 126752228) has the molecular formula C18H18ClN7O2 and a molecular weight of 399.84 g/mol. Its IUPAC name is 3-[[3-[2-(4-chlorophenyl)ethyl]-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-7-(methylamino)imidazo[5,1-f][1,2,4]triazin-4-one.
| Compound Name | 3-[[3-[2-(4-chlorophenyl)ethyl]-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-7-(methylamino)imidazo[5,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 126752228 |
| Molecular Formula | C18H18ClN7O2 |
| Molecular Weight | 399.84 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 3-[[3-[2-(4-chlorophenyl)ethyl]-1,2,4-oxadiazol-5-yl]methyl]-5-methyl-7-(methylamino)imidazo[5,1-f][1,2,4]triazin-4-one |
| SMILES | CNc1nc(C)c2c(=O)n(Cc3nc(CCc4ccc(Cl)cc4)no3)cnn12 |
| InChI | InChI=1S/C18H18ClN7O2/c1-11-16-17(27)25(10-21-26(16)18(20-2)22-11)9-15-23-14(24-28-15)8-5-12-3-6-13(19)7-4-12/h3-4,6-7,10H,5,8-9H2,1-2H3,(H,20,22) |
| InChIKey | SPAFUOJQGDPAJR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 103.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.84 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |