C25H28F2N2O4 — CID 126752347
(3R)-6-[2-[[2-[4-(difluoromethoxy)phenyl]-5-methylimidazol-1-yl]methyl]phenoxy]-3-methylhexanoic acid (PubChem CID 126752347) has the molecular formula C25H28F2N2O4 and a molecular weight of 458.51 g/mol. Its IUPAC name is (3R)-6-[2-[[2-[4-(difluoromethoxy)phenyl]-5-methylimidazol-1-yl]methyl]phenoxy]-3-methylhexanoic acid.
| Compound Name | (3R)-6-[2-[[2-[4-(difluoromethoxy)phenyl]-5-methylimidazol-1-yl]methyl]phenoxy]-3-methylhexanoic acid |
|---|---|
| PubChem CID | 126752347 |
| Molecular Formula | C25H28F2N2O4 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | (3R)-6-[2-[[2-[4-(difluoromethoxy)phenyl]-5-methylimidazol-1-yl]methyl]phenoxy]-3-methylhexanoic acid |
| SMILES | Cc1cnc(-c2ccc(OC(F)F)cc2)n1Cc1ccccc1OCCC[C@@H](C)CC(=O)O |
| InChI | InChI=1S/C25H28F2N2O4/c1-17(14-23(30)31)6-5-13-32-22-8-4-3-7-20(22)16-29-18(2)15-28-24(29)19-9-11-21(12-10-19)33-25(26)27/h3-4,7-12,15,17,25H,5-6,13-14,16H2,1-2H3,(H,30,31)/t17-/m1/s1 |
| InChIKey | IMECUCANUVGFRR-QGZVFWFLSA-N |
| XLogP | 5.78 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|