About 1-tert-butyl-2-(4,4-difluorocyclohexyl)hydrazine
1-tert-butyl-2-(4,4-difluorocyclohexyl)hydrazine (PubChem CID 126752421) has the molecular formula C10H20F2N2
and a molecular weight of 206.28 g/mol. Its IUPAC name is 1-tert-butyl-2-(4,4-difluorocyclohexyl)hydrazine.
Molecular Properties
| Compound Name | 1-tert-butyl-2-(4,4-difluorocyclohexyl)hydrazine |
| PubChem CID | 126752421 |
| Molecular Formula | C10H20F2N2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.16 |
| IUPAC Name | 1-tert-butyl-2-(4,4-difluorocyclohexyl)hydrazine |
| SMILES | CC(C)(C)NNC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C10H20F2N2/c1-9(2,3)14-13-8-4-6-10(11,12)7-5-8/h8,13-14H,4-7H2,1-3H3 |
| InChIKey | KCMRBMFKFRTRRF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-2-(4,4-difluorocyclohexyl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-2-(4,4-difluorocyclohexyl)hydrazine?
The IUPAC name of 1-tert-butyl-2-(4,4-difluorocyclohexyl)hydrazine (CID 126752421) is 1-tert-butyl-2-(4,4-difluorocyclohexyl)hydrazine.
What is the SMILES notation for 1-tert-butyl-2-(4,4-difluorocyclohexyl)hydrazine?
The canonical SMILES for 1-tert-butyl-2-(4,4-difluorocyclohexyl)hydrazine is CC(C)(C)NNC1CCC(F)(F)CC1.
What is the InChIKey of 1-tert-butyl-2-(4,4-difluorocyclohexyl)hydrazine?
The InChIKey is KCMRBMFKFRTRRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20F2N2/c1-9(2,3)14-13-8-4-6-10(11,12)7-5-8/h8,13-14H,4-7H2,1-3H3.
What are the key properties of 1-tert-butyl-2-(4,4-difluorocyclohexyl)hydrazine?
1-tert-butyl-2-(4,4-difluorocyclohexyl)hydrazine has a molecular weight of 206.28 g/mol, XLogP of 2.46, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-2-(4,4-difluorocyclohexyl)hydrazine is sourced from PubChem (CID 126752421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).