C12H16BrClO — CID 126752545
4-bromo-2-chloro-1-(2,2-dimethylbutoxy)benzene (PubChem CID 126752545) has the molecular formula C12H16BrClO and a molecular weight of 291.62 g/mol. Its IUPAC name is 4-bromo-2-chloro-1-(2,2-dimethylbutoxy)benzene.
| Compound Name | 4-bromo-2-chloro-1-(2,2-dimethylbutoxy)benzene |
|---|---|
| PubChem CID | 126752545 |
| Molecular Formula | C12H16BrClO |
| Molecular Weight | 291.62 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 4-bromo-2-chloro-1-(2,2-dimethylbutoxy)benzene |
| SMILES | CCC(C)(C)COc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C12H16BrClO/c1-4-12(2,3)8-15-11-6-5-9(13)7-10(11)14/h5-7H,4,8H2,1-3H3 |
| InChIKey | CKFXIQSYHBCJEP-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.62 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |