C35H36N6O2 — CID 126754790
1-[3-[3-[(4-ethyl-1,3,4,5-tetrahydro-2-benzazepin-2-yl)methyl]phenyl]phenyl]-5-[(1R,2R)-2-(1-methyltriazol-4-yl)cyclopropyl]pyrazole-4-carboxylic acid (PubChem CID 126754790) has the molecular formula C35H36N6O2 and a molecular weight of 572.71 g/mol. Its IUPAC name is 1-[3-[3-[(4-ethyl-1,3,4,5-tetrahydro-2-benzazepin-2-yl)methyl]phenyl]phenyl]-5-[(1R,2R)-2-(1-methyltriazol-4-yl)cyclopropyl]pyrazole-4-carboxylic acid.
| Compound Name | 1-[3-[3-[(4-ethyl-1,3,4,5-tetrahydro-2-benzazepin-2-yl)methyl]phenyl]phenyl]-5-[(1R,2R)-2-(1-methyltriazol-4-yl)cyclopropyl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 126754790 |
| Molecular Formula | C35H36N6O2 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.29 |
| IUPAC Name | 1-[3-[3-[(4-ethyl-1,3,4,5-tetrahydro-2-benzazepin-2-yl)methyl]phenyl]phenyl]-5-[(1R,2R)-2-(1-methyltriazol-4-yl)cyclopropyl]pyrazole-4-carboxylic acid |
| SMILES | CCC1Cc2ccccc2CN(Cc2cccc(-c3cccc(-n4ncc(C(=O)O)c4[C@@H]4C[C@H]4c4cn(C)nn4)c3)c2)C1 |
| InChI | InChI=1S/C35H36N6O2/c1-3-23-14-26-9-4-5-10-28(26)21-40(19-23)20-24-8-6-11-25(15-24)27-12-7-13-29(16-27)41-34(32(18-36-41)35(42)43)31-17-30(31)33-22-39(2)38-37-33/h4-13,15-16,18,22-23,30-31H,3,14,17,19-21H2,1-2H3,(H,42,43)/t23?,30-,31-/m1/s1 |
| InChIKey | CRDUDAIHTGFVLU-BACCKDGZSA-N |
| XLogP | 6.22 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |