C18H18ClF3N6O2 — CID 126755212
N-[3-[(4R,6S)-2-amino-4-(difluoromethyl)-6-hydrazinyl-5,6-dihydro-1,3-oxazin-4-yl]-4-fluoro-5-methylphenyl]-5-chloropyridine-2-carboxamide (PubChem CID 126755212) has the molecular formula C18H18ClF3N6O2 and a molecular weight of 442.83 g/mol. Its IUPAC name is N-[3-[(4R,6S)-2-amino-4-(difluoromethyl)-6-hydrazinyl-5,6-dihydro-1,3-oxazin-4-yl]-4-fluoro-5-methylphenyl]-5-chloropyridine-2-carboxamide.
| Compound Name | N-[3-[(4R,6S)-2-amino-4-(difluoromethyl)-6-hydrazinyl-5,6-dihydro-1,3-oxazin-4-yl]-4-fluoro-5-methylphenyl]-5-chloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 126755212 |
| Molecular Formula | C18H18ClF3N6O2 |
| Molecular Weight | 442.83 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | N-[3-[(4R,6S)-2-amino-4-(difluoromethyl)-6-hydrazinyl-5,6-dihydro-1,3-oxazin-4-yl]-4-fluoro-5-methylphenyl]-5-chloropyridine-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccc(Cl)cn2)cc([C@@]2(C(F)F)C[C@@H](NN)OC(N)=N2)c1F |
| InChI | InChI=1S/C18H18ClF3N6O2/c1-8-4-10(26-15(29)12-3-2-9(19)7-25-12)5-11(14(8)20)18(16(21)22)6-13(28-24)30-17(23)27-18/h2-5,7,13,16,28H,6,24H2,1H3,(H2,23,27)(H,26,29)/t13-,18+/m0/s1 |
| InChIKey | LSQBFVUXTBWLBD-SCLBCKFNSA-N |
| XLogP | 2.42 |
| TPSA | 127.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.83 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|