About (Z,2R)-5,9-dimethyl-2-methylphosphanyldec-3-en-1-amine
(Z,2R)-5,9-dimethyl-2-methylphosphanyldec-3-en-1-amine (PubChem CID 126755705) has the molecular formula C13H28NP
and a molecular weight of 229.35 g/mol. Its IUPAC name is (Z,2R)-5,9-dimethyl-2-methylphosphanyldec-3-en-1-amine.
Molecular Properties
| Compound Name | (Z,2R)-5,9-dimethyl-2-methylphosphanyldec-3-en-1-amine |
| PubChem CID | 126755705 |
| Molecular Formula | C13H28NP |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | (Z,2R)-5,9-dimethyl-2-methylphosphanyldec-3-en-1-amine |
| SMILES | CP[C@H](/C=C\C(C)CCCC(C)C)CN |
| InChI | InChI=1S/C13H28NP/c1-11(2)6-5-7-12(3)8-9-13(10-14)15-4/h8-9,11-13,15H,5-7,10,14H2,1-4H3/b9-8-/t12?,13-/m1/s1 |
| InChIKey | ZSAOWYPXKQPLQJ-LMROZPDVSA-N |
| XLogP | 3.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (Z,2R)-5,9-dimethyl-2-methylphosphanyldec-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,2R)-5,9-dimethyl-2-methylphosphanyldec-3-en-1-amine?
The IUPAC name of (Z,2R)-5,9-dimethyl-2-methylphosphanyldec-3-en-1-amine (CID 126755705) is (Z,2R)-5,9-dimethyl-2-methylphosphanyldec-3-en-1-amine.
What is the SMILES notation for (Z,2R)-5,9-dimethyl-2-methylphosphanyldec-3-en-1-amine?
The canonical SMILES for (Z,2R)-5,9-dimethyl-2-methylphosphanyldec-3-en-1-amine is CP[C@H](/C=C\C(C)CCCC(C)C)CN.
What is the InChIKey of (Z,2R)-5,9-dimethyl-2-methylphosphanyldec-3-en-1-amine?
The InChIKey is ZSAOWYPXKQPLQJ-LMROZPDVSA-N. The full InChI is InChI=1S/C13H28NP/c1-11(2)6-5-7-12(3)8-9-13(10-14)15-4/h8-9,11-13,15H,5-7,10,14H2,1-4H3/b9-8-/t12?,13-/m1/s1.
What are the key properties of (Z,2R)-5,9-dimethyl-2-methylphosphanyldec-3-en-1-amine?
(Z,2R)-5,9-dimethyl-2-methylphosphanyldec-3-en-1-amine has a molecular weight of 229.35 g/mol, XLogP of 3.64, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,2R)-5,9-dimethyl-2-methylphosphanyldec-3-en-1-amine is sourced from PubChem (CID 126755705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).