About (4R)-2-fluoro-3-methyl-4,7-dihydropurin-6-amine
(4R)-2-fluoro-3-methyl-4,7-dihydropurin-6-amine (PubChem CID 126756043) has the molecular formula C6H8FN5
and a molecular weight of 169.16 g/mol. Its IUPAC name is (4R)-2-fluoro-3-methyl-4,7-dihydropurin-6-amine.
Molecular Properties
| Compound Name | (4R)-2-fluoro-3-methyl-4,7-dihydropurin-6-amine |
| PubChem CID | 126756043 |
| Molecular Formula | C6H8FN5 |
| Molecular Weight | 169.16 g/mol |
| Exact Mass | 169.08 |
| IUPAC Name | (4R)-2-fluoro-3-methyl-4,7-dihydropurin-6-amine |
| SMILES | CN1C(F)=NC(N)=C2NC=N[C@@H]21 |
| InChI | InChI=1S/C6H8FN5/c1-12-5-3(9-2-10-5)4(8)11-6(12)7/h2,5H,8H2,1H3,(H,9,10)/t5-/m1/s1 |
| InChIKey | KLSPYZGUROSGLH-RXMQYKEDSA-N |
| XLogP | -0.66 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.16 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (4R)-2-fluoro-3-methyl-4,7-dihydropurin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2-fluoro-3-methyl-4,7-dihydropurin-6-amine?
The IUPAC name of (4R)-2-fluoro-3-methyl-4,7-dihydropurin-6-amine (CID 126756043) is (4R)-2-fluoro-3-methyl-4,7-dihydropurin-6-amine.
What is the SMILES notation for (4R)-2-fluoro-3-methyl-4,7-dihydropurin-6-amine?
The canonical SMILES for (4R)-2-fluoro-3-methyl-4,7-dihydropurin-6-amine is CN1C(F)=NC(N)=C2NC=N[C@@H]21.
What is the InChIKey of (4R)-2-fluoro-3-methyl-4,7-dihydropurin-6-amine?
The InChIKey is KLSPYZGUROSGLH-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H8FN5/c1-12-5-3(9-2-10-5)4(8)11-6(12)7/h2,5H,8H2,1H3,(H,9,10)/t5-/m1/s1.
What are the key properties of (4R)-2-fluoro-3-methyl-4,7-dihydropurin-6-amine?
(4R)-2-fluoro-3-methyl-4,7-dihydropurin-6-amine has a molecular weight of 169.16 g/mol, XLogP of -0.66, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2-fluoro-3-methyl-4,7-dihydropurin-6-amine is sourced from PubChem (CID 126756043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).