About N-[4-amino-6-[[(2R)-2,3-dimethylbutyl]amino]pyrimidin-5-yl]ethanimidoyl fluoride
N-[4-amino-6-[[(2R)-2,3-dimethylbutyl]amino]pyrimidin-5-yl]ethanimidoyl fluoride (PubChem CID 126756083) has the molecular formula C12H20FN5
and a molecular weight of 253.32 g/mol. Its IUPAC name is N-[4-amino-6-[[(2R)-2,3-dimethylbutyl]amino]pyrimidin-5-yl]ethanimidoyl fluoride.
Molecular Properties
| Compound Name | N-[4-amino-6-[[(2R)-2,3-dimethylbutyl]amino]pyrimidin-5-yl]ethanimidoyl fluoride |
| PubChem CID | 126756083 |
| Molecular Formula | C12H20FN5 |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | N-[4-amino-6-[[(2R)-2,3-dimethylbutyl]amino]pyrimidin-5-yl]ethanimidoyl fluoride |
| SMILES | C/C(F)=N\c1c(N)ncnc1NC[C@H](C)C(C)C |
| InChI | InChI=1S/C12H20FN5/c1-7(2)8(3)5-15-12-10(18-9(4)13)11(14)16-6-17-12/h6-8H,5H2,1-4H3,(H3,14,15,16,17)/b18-9+/t8-/m0/s1 |
| InChIKey | GKHBNXXJFDFOGA-YQWWIIDMSA-N |
| XLogP | 2.78 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[4-amino-6-[[(2R)-2,3-dimethylbutyl]amino]pyrimidin-5-yl]ethanimidoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-amino-6-[[(2R)-2,3-dimethylbutyl]amino]pyrimidin-5-yl]ethanimidoyl fluoride?
The IUPAC name of N-[4-amino-6-[[(2R)-2,3-dimethylbutyl]amino]pyrimidin-5-yl]ethanimidoyl fluoride (CID 126756083) is N-[4-amino-6-[[(2R)-2,3-dimethylbutyl]amino]pyrimidin-5-yl]ethanimidoyl fluoride.
What is the SMILES notation for N-[4-amino-6-[[(2R)-2,3-dimethylbutyl]amino]pyrimidin-5-yl]ethanimidoyl fluoride?
The canonical SMILES for N-[4-amino-6-[[(2R)-2,3-dimethylbutyl]amino]pyrimidin-5-yl]ethanimidoyl fluoride is C/C(F)=N\c1c(N)ncnc1NC[C@H](C)C(C)C.
What is the InChIKey of N-[4-amino-6-[[(2R)-2,3-dimethylbutyl]amino]pyrimidin-5-yl]ethanimidoyl fluoride?
The InChIKey is GKHBNXXJFDFOGA-YQWWIIDMSA-N. The full InChI is InChI=1S/C12H20FN5/c1-7(2)8(3)5-15-12-10(18-9(4)13)11(14)16-6-17-12/h6-8H,5H2,1-4H3,(H3,14,15,16,17)/b18-9+/t8-/m0/s1.
What are the key properties of N-[4-amino-6-[[(2R)-2,3-dimethylbutyl]amino]pyrimidin-5-yl]ethanimidoyl fluoride?
N-[4-amino-6-[[(2R)-2,3-dimethylbutyl]amino]pyrimidin-5-yl]ethanimidoyl fluoride has a molecular weight of 253.32 g/mol, XLogP of 2.78, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-amino-6-[[(2R)-2,3-dimethylbutyl]amino]pyrimidin-5-yl]ethanimidoyl fluoride is sourced from PubChem (CID 126756083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).