C12H15FN2O2 — CID 126756406
4-[(3E,5E)-3-fluoro-5-isocyanatohepta-1,3,5-trien-2-yl]morpholine (PubChem CID 126756406) has the molecular formula C12H15FN2O2 and a molecular weight of 238.26 g/mol. Its IUPAC name is 4-[(3E,5E)-3-fluoro-5-isocyanatohepta-1,3,5-trien-2-yl]morpholine.
| Compound Name | 4-[(3E,5E)-3-fluoro-5-isocyanatohepta-1,3,5-trien-2-yl]morpholine |
|---|---|
| PubChem CID | 126756406 |
| Molecular Formula | C12H15FN2O2 |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 4-[(3E,5E)-3-fluoro-5-isocyanatohepta-1,3,5-trien-2-yl]morpholine |
| SMILES | C=C(/C(F)=C/C(=C\C)N=C=O)N1CCOCC1 |
| InChI | InChI=1S/C12H15FN2O2/c1-3-11(14-9-16)8-12(13)10(2)15-4-6-17-7-5-15/h3,8H,2,4-7H2,1H3/b11-3+,12-8+ |
| InChIKey | ICFUDUVJAWSCEU-ZOADREODSA-N |
| XLogP | 1.93 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|