C12H15N5OS2 — CID 126756629
6-(methylaminosulfanylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carbaldehyde (PubChem CID 126756629) has the molecular formula C12H15N5OS2 and a molecular weight of 309.42 g/mol. Its IUPAC name is 6-(methylaminosulfanylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carbaldehyde.
| Compound Name | 6-(methylaminosulfanylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carbaldehyde |
|---|---|
| PubChem CID | 126756629 |
| Molecular Formula | C12H15N5OS2 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 6-(methylaminosulfanylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carbaldehyde |
| SMILES | CNSNC1CC2=C(C=O)CN=C(c3nccs3)N2C1 |
| InChI | InChI=1S/C12H15N5OS2/c1-13-20-16-9-4-10-8(7-18)5-15-11(17(10)6-9)12-14-2-3-19-12/h2-3,7,9,13,16H,4-6H2,1H3 |
| InChIKey | IVFFHYPREWYUAK-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|