C16H23N5O2S2 — CID 126756696
methyl (6S)-6-(butylaminosulfanylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate (PubChem CID 126756696) has the molecular formula C16H23N5O2S2 and a molecular weight of 381.53 g/mol. Its IUPAC name is methyl (6S)-6-(butylaminosulfanylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate.
| Compound Name | methyl (6S)-6-(butylaminosulfanylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 126756696 |
| Molecular Formula | C16H23N5O2S2 |
| Molecular Weight | 381.53 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | methyl (6S)-6-(butylaminosulfanylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
| SMILES | CCCCNSN[C@H]1CC2=C(C(=O)OC)CN=C(c3nccs3)N2C1 |
| InChI | InChI=1S/C16H23N5O2S2/c1-3-4-5-19-25-20-11-8-13-12(16(22)23-2)9-18-14(21(13)10-11)15-17-6-7-24-15/h6-7,11,19-20H,3-5,8-10H2,1-2H3/t11-/m0/s1 |
| InChIKey | UTDXZBYKZICPRE-NSHDSACASA-N |
| XLogP | 1.95 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.53 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|