C15H15F3N4O3S2 — CID 126756704
ethyl 1-(1,3-thiazol-2-yl)-6-(trifluoromethylsulfanylcarbamoyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate (PubChem CID 126756704) has the molecular formula C15H15F3N4O3S2 and a molecular weight of 420.44 g/mol. Its IUPAC name is ethyl 1-(1,3-thiazol-2-yl)-6-(trifluoromethylsulfanylcarbamoyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate.
| Compound Name | ethyl 1-(1,3-thiazol-2-yl)-6-(trifluoromethylsulfanylcarbamoyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 126756704 |
| Molecular Formula | C15H15F3N4O3S2 |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | ethyl 1-(1,3-thiazol-2-yl)-6-(trifluoromethylsulfanylcarbamoyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
| SMILES | CCOC(=O)C1=C2CC(C(=O)NSC(F)(F)F)CN2C(c2nccs2)=NC1 |
| InChI | InChI=1S/C15H15F3N4O3S2/c1-2-25-14(24)9-6-20-11(13-19-3-4-26-13)22-7-8(5-10(9)22)12(23)21-27-15(16,17)18/h3-4,8H,2,5-7H2,1H3,(H,21,23) |
| InChIKey | RDKRDBDXEVJXJK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|