C18H16BrFN4OS — CID 126757055
(3R)-3-(2-bromo-4-fluorophenyl)-6-(methylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carbaldehyde (PubChem CID 126757055) has the molecular formula C18H16BrFN4OS and a molecular weight of 435.32 g/mol. Its IUPAC name is (3R)-3-(2-bromo-4-fluorophenyl)-6-(methylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carbaldehyde.
| Compound Name | (3R)-3-(2-bromo-4-fluorophenyl)-6-(methylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carbaldehyde |
|---|---|
| PubChem CID | 126757055 |
| Molecular Formula | C18H16BrFN4OS |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | (3R)-3-(2-bromo-4-fluorophenyl)-6-(methylamino)-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carbaldehyde |
| SMILES | CNC1CC2=C(C=O)[C@H](c3ccc(F)cc3Br)N=C(c3nccs3)N2C1 |
| InChI | InChI=1S/C18H16BrFN4OS/c1-21-11-7-15-13(9-25)16(12-3-2-10(20)6-14(12)19)23-17(24(15)8-11)18-22-4-5-26-18/h2-6,9,11,16,21H,7-8H2,1H3/t11?,16-/m0/s1 |
| InChIKey | BACNNJMGKKGYSA-NBFOKTCDSA-N |
| XLogP | 3.29 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|