C12H11F3N4O2S2 — CID 126757281
1,1,1-trifluoro-N-[4-formyl-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methanesulfinamide (PubChem CID 126757281) has the molecular formula C12H11F3N4O2S2 and a molecular weight of 364.37 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[4-formyl-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methanesulfinamide.
| Compound Name | 1,1,1-trifluoro-N-[4-formyl-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methanesulfinamide |
|---|---|
| PubChem CID | 126757281 |
| Molecular Formula | C12H11F3N4O2S2 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | 1,1,1-trifluoro-N-[4-formyl-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methanesulfinamide |
| SMILES | O=CC1=C2CC(NS(=O)C(F)(F)F)CN2C(c2nccs2)=NC1 |
| InChI | InChI=1S/C12H11F3N4O2S2/c13-12(14,15)23(21)18-8-3-9-7(6-20)4-17-10(19(9)5-8)11-16-1-2-22-11/h1-2,6,8,18H,3-5H2 |
| InChIKey | MXTGGJPQXDNRRS-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|