C22H26F3NO2 — CID 126757455
4-[(Z)-1-methoxyprop-1-enyl]-1-[2,2,2-trifluoro-1-(6-methoxynaphthalen-2-yl)ethyl]piperidine (PubChem CID 126757455) has the molecular formula C22H26F3NO2 and a molecular weight of 393.45 g/mol. Its IUPAC name is 4-[(Z)-1-methoxyprop-1-enyl]-1-[2,2,2-trifluoro-1-(6-methoxynaphthalen-2-yl)ethyl]piperidine.
| Compound Name | 4-[(Z)-1-methoxyprop-1-enyl]-1-[2,2,2-trifluoro-1-(6-methoxynaphthalen-2-yl)ethyl]piperidine |
|---|---|
| PubChem CID | 126757455 |
| Molecular Formula | C22H26F3NO2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 4-[(Z)-1-methoxyprop-1-enyl]-1-[2,2,2-trifluoro-1-(6-methoxynaphthalen-2-yl)ethyl]piperidine |
| SMILES | C/C=C(\OC)C1CCN(C(c2ccc3cc(OC)ccc3c2)C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H26F3NO2/c1-4-20(28-3)15-9-11-26(12-10-15)21(22(23,24)25)18-6-5-17-14-19(27-2)8-7-16(17)13-18/h4-8,13-15,21H,9-12H2,1-3H3/b20-4- |
| InChIKey | FSSYPDFAGQVHPD-YQLNASGTSA-N |
| XLogP | 5.71 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|